C14H17BrFNO2 — CID 106123468
2-bromo-4-fluoro-N-[(4-hydroxycyclohexyl)methyl]benzamide (PubChem CID 106123468) has the molecular formula C14H17BrFNO2 and a molecular weight of 330.20 g/mol. Its IUPAC name is 2-bromo-4-fluoro-N-[(4-hydroxycyclohexyl)methyl]benzamide.
| Compound Name | 2-bromo-4-fluoro-N-[(4-hydroxycyclohexyl)methyl]benzamide |
|---|---|
| PubChem CID | 106123468 |
| Molecular Formula | C14H17BrFNO2 |
| Molecular Weight | 330.20 g/mol |
| Exact Mass | 329.04 |
| IUPAC Name | 2-bromo-4-fluoro-N-[(4-hydroxycyclohexyl)methyl]benzamide |
| SMILES | O=C(NCC1CCC(O)CC1)c1ccc(F)cc1Br |
| InChI | InChI=1S/C14H17BrFNO2/c15-13-7-10(16)3-6-12(13)14(19)17-8-9-1-4-11(18)5-2-9/h3,6-7,9,11,18H,1-2,4-5,8H2,(H,17,19) |
| InChIKey | NHTVWGKDMUSIBV-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.20 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |