C18H23BrFNO3 — CID 167042183
methyl (Z)-2-(2-bromo-4-fluorophenyl)-3-[(4-hydroxycyclohexyl)methylamino]but-2-enoate (PubChem CID 167042183) has the molecular formula C18H23BrFNO3 and a molecular weight of 400.29 g/mol. Its IUPAC name is methyl (Z)-2-(2-bromo-4-fluorophenyl)-3-[(4-hydroxycyclohexyl)methylamino]but-2-enoate.
| Compound Name | methyl (Z)-2-(2-bromo-4-fluorophenyl)-3-[(4-hydroxycyclohexyl)methylamino]but-2-enoate |
|---|---|
| PubChem CID | 167042183 |
| Molecular Formula | C18H23BrFNO3 |
| Molecular Weight | 400.29 g/mol |
| Exact Mass | 399.08 |
| IUPAC Name | methyl (Z)-2-(2-bromo-4-fluorophenyl)-3-[(4-hydroxycyclohexyl)methylamino]but-2-enoate |
| SMILES | COC(=O)/C(=C(/C)NCC1CCC(O)CC1)c1ccc(F)cc1Br |
| InChI | InChI=1S/C18H23BrFNO3/c1-11(21-10-12-3-6-14(22)7-4-12)17(18(23)24-2)15-8-5-13(20)9-16(15)19/h5,8-9,12,14,21-22H,3-4,6-7,10H2,1-2H3/b17-11- |
| InChIKey | JCYBWSKXOMUPGM-BOPFTXTBSA-N |
| XLogP | 3.63 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.29 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|