C16H19FN2O3 — CID 46653754
N'-(2-cyclopent-2-en-1-ylacetyl)-2-(2-fluorophenoxy)propanehydrazide (PubChem CID 46653754) has the molecular formula C16H19FN2O3 and a molecular weight of 306.34 g/mol. Its IUPAC name is N'-(2-cyclopent-2-en-1-ylacetyl)-2-(2-fluorophenoxy)propanehydrazide.
| Compound Name | N'-(2-cyclopent-2-en-1-ylacetyl)-2-(2-fluorophenoxy)propanehydrazide |
|---|---|
| PubChem CID | 46653754 |
| Molecular Formula | C16H19FN2O3 |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | N'-(2-cyclopent-2-en-1-ylacetyl)-2-(2-fluorophenoxy)propanehydrazide |
| SMILES | CC(Oc1ccccc1F)C(=O)NNC(=O)CC1C=CCC1 |
| InChI | InChI=1S/C16H19FN2O3/c1-11(22-14-9-5-4-8-13(14)17)16(21)19-18-15(20)10-12-6-2-3-7-12/h2,4-6,8-9,11-12H,3,7,10H2,1H3,(H,18,20)(H,19,21) |
| InChIKey | CGXPBPMOHCOTHJ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|