C15H19FN2O5S2 — CID 9373593
(2S)-N'-[2-[(3R)-1,1-dioxothiolan-3-yl]sulfanylacetyl]-2-(2-fluorophenoxy)propanehydrazide (PubChem CID 9373593) has the molecular formula C15H19FN2O5S2 and a molecular weight of 390.46 g/mol. Its IUPAC name is (2S)-N'-[2-[(3R)-1,1-dioxothiolan-3-yl]sulfanylacetyl]-2-(2-fluorophenoxy)propanehydrazide.
| Compound Name | (2S)-N'-[2-[(3R)-1,1-dioxothiolan-3-yl]sulfanylacetyl]-2-(2-fluorophenoxy)propanehydrazide |
|---|---|
| PubChem CID | 9373593 |
| Molecular Formula | C15H19FN2O5S2 |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | (2S)-N'-[2-[(3R)-1,1-dioxothiolan-3-yl]sulfanylacetyl]-2-(2-fluorophenoxy)propanehydrazide |
| SMILES | C[C@H](Oc1ccccc1F)C(=O)NNC(=O)CS[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H19FN2O5S2/c1-10(23-13-5-3-2-4-12(13)16)15(20)18-17-14(19)8-24-11-6-7-25(21,22)9-11/h2-5,10-11H,6-9H2,1H3,(H,17,19)(H,18,20)/t10-,11+/m0/s1 |
| InChIKey | JNUPXHXNSXDSHC-WDEREUQCSA-N |
| XLogP | 0.66 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|