C15H16N2O4 — CID 9273888
N'-[2-[(1S)-cyclopent-2-en-1-yl]acetyl]-1,3-benzodioxole-5-carbohydrazide (PubChem CID 9273888) has the molecular formula C15H16N2O4 and a molecular weight of 288.30 g/mol. Its IUPAC name is N'-[2-[(1S)-cyclopent-2-en-1-yl]acetyl]-1,3-benzodioxole-5-carbohydrazide.
| Compound Name | N'-[2-[(1S)-cyclopent-2-en-1-yl]acetyl]-1,3-benzodioxole-5-carbohydrazide |
|---|---|
| PubChem CID | 9273888 |
| Molecular Formula | C15H16N2O4 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | N'-[2-[(1S)-cyclopent-2-en-1-yl]acetyl]-1,3-benzodioxole-5-carbohydrazide |
| SMILES | O=C(C[C@H]1C=CCC1)NNC(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H16N2O4/c18-14(7-10-3-1-2-4-10)16-17-15(19)11-5-6-12-13(8-11)21-9-20-12/h1,3,5-6,8,10H,2,4,7,9H2,(H,16,18)(H,17,19)/t10-/m0/s1 |
| InChIKey | MGXKOEYWWKEPSA-JTQLQIEISA-N |
| XLogP | 1.53 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|