C17H20N2O4 — CID 11940962
N'-[2-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]acetyl]-1,3-benzodioxole-5-carbohydrazide (PubChem CID 11940962) has the molecular formula C17H20N2O4 and a molecular weight of 316.36 g/mol. Its IUPAC name is N'-[2-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]acetyl]-1,3-benzodioxole-5-carbohydrazide.
| Compound Name | N'-[2-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]acetyl]-1,3-benzodioxole-5-carbohydrazide |
|---|---|
| PubChem CID | 11940962 |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | N'-[2-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]acetyl]-1,3-benzodioxole-5-carbohydrazide |
| SMILES | O=C(C[C@H]1C[C@H]2CC[C@@H]1C2)NNC(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H20N2O4/c20-16(8-13-6-10-1-2-11(13)5-10)18-19-17(21)12-3-4-14-15(7-12)23-9-22-14/h3-4,7,10-11,13H,1-2,5-6,8-9H2,(H,18,20)(H,19,21)/t10-,11+,13+/m0/s1 |
| InChIKey | ULRGQTOWWGVPOM-DMDPSCGWSA-N |
| XLogP | 2.00 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|