C16H18N2O3 — CID 98220984
N-[(Z)-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]methylideneamino]-1,3-benzodioxole-5-carboxamide (PubChem CID 98220984) has the molecular formula C16H18N2O3 and a molecular weight of 286.33 g/mol. Its IUPAC name is N-[(Z)-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]methylideneamino]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[(Z)-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]methylideneamino]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 98220984 |
| Molecular Formula | C16H18N2O3 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | N-[(Z)-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]methylideneamino]-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(N/N=C\[C@@H]1C[C@@H]2CC[C@@H]1C2)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H18N2O3/c19-16(12-3-4-14-15(7-12)21-9-20-14)18-17-8-13-6-10-1-2-11(13)5-10/h3-4,7-8,10-11,13H,1-2,5-6,9H2,(H,18,19)/b17-8-/t10-,11-,13+/m1/s1 |
| InChIKey | UVDLSJWAMABVIP-LFSOKBLNSA-N |
| XLogP | 2.57 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|