C15H17ClN2O2 — CID 11880265
N-[(Z)-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]methylideneamino]-5-chloro-2-hydroxybenzamide (PubChem CID 11880265) has the molecular formula C15H17ClN2O2 and a molecular weight of 292.77 g/mol. Its IUPAC name is N-[(Z)-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]methylideneamino]-5-chloro-2-hydroxybenzamide.
| Compound Name | N-[(Z)-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]methylideneamino]-5-chloro-2-hydroxybenzamide |
|---|---|
| PubChem CID | 11880265 |
| Molecular Formula | C15H17ClN2O2 |
| Molecular Weight | 292.77 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | N-[(Z)-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]methylideneamino]-5-chloro-2-hydroxybenzamide |
| SMILES | O=C(N/N=C\[C@H]1C[C@H]2CC[C@@H]1C2)c1cc(Cl)ccc1O |
| InChI | InChI=1S/C15H17ClN2O2/c16-12-3-4-14(19)13(7-12)15(20)18-17-8-11-6-9-1-2-10(11)5-9/h3-4,7-11,19H,1-2,5-6H2,(H,18,20)/b17-8-/t9-,10+,11+/m0/s1 |
| InChIKey | CGKRQBJNWZFUNJ-KDLFJMKCSA-N |
| XLogP | 3.20 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.77 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|