C17H19N3O — CID 6545059
N-[(Z)-[(1S,2R,4R)-2-bicyclo[2.2.1]heptanyl]methylideneamino]-1H-indole-3-carboxamide (PubChem CID 6545059) has the molecular formula C17H19N3O and a molecular weight of 281.36 g/mol. Its IUPAC name is N-[(Z)-[(1S,2R,4R)-2-bicyclo[2.2.1]heptanyl]methylideneamino]-1H-indole-3-carboxamide.
| Compound Name | N-[(Z)-[(1S,2R,4R)-2-bicyclo[2.2.1]heptanyl]methylideneamino]-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 6545059 |
| Molecular Formula | C17H19N3O |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | N-[(Z)-[(1S,2R,4R)-2-bicyclo[2.2.1]heptanyl]methylideneamino]-1H-indole-3-carboxamide |
| SMILES | O=C(N/N=C\[C@@H]1C[C@@H]2CC[C@H]1C2)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C17H19N3O/c21-17(15-10-18-16-4-2-1-3-14(15)16)20-19-9-13-8-11-5-6-12(13)7-11/h1-4,9-13,18H,5-8H2,(H,20,21)/b19-9-/t11-,12+,13+/m1/s1 |
| InChIKey | MPCFNUBUCZFVAW-HDBIQAQTSA-N |
| XLogP | 3.32 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|