C17H17NO — CID 114096973
1H-indol-3-yl(3-tricyclo[3.2.1.02,4]octanyl)methanone (PubChem CID 114096973) has the molecular formula C17H17NO and a molecular weight of 251.33 g/mol. Its IUPAC name is 1H-indol-3-yl(3-tricyclo[3.2.1.02,4]octanyl)methanone.
| Compound Name | 1H-indol-3-yl(3-tricyclo[3.2.1.02,4]octanyl)methanone |
|---|---|
| PubChem CID | 114096973 |
| Molecular Formula | C17H17NO |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 1H-indol-3-yl(3-tricyclo[3.2.1.02,4]octanyl)methanone |
| SMILES | O=C(c1c[nH]c2ccccc12)C1C2C3CCC(C3)C12 |
| InChI | InChI=1S/C17H17NO/c19-17(12-8-18-13-4-2-1-3-11(12)13)16-14-9-5-6-10(7-9)15(14)16/h1-4,8-10,14-16,18H,5-7H2 |
| InChIKey | APHUYNIZXBKCCR-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |