C16H14NO3- — CID 11859762
(1S,6R)-6-(1H-indole-3-carbonyl)cyclohex-3-ene-1-carboxylate (PubChem CID 11859762) has the molecular formula C16H14NO3- and a molecular weight of 268.29 g/mol. Its IUPAC name is (1S,6R)-6-(1H-indole-3-carbonyl)cyclohex-3-ene-1-carboxylate.
| Compound Name | (1S,6R)-6-(1H-indole-3-carbonyl)cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 11859762 |
| Molecular Formula | C16H14NO3- |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | (1S,6R)-6-(1H-indole-3-carbonyl)cyclohex-3-ene-1-carboxylate |
| SMILES | O=C([O-])[C@H]1CC=CC[C@H]1C(=O)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C16H15NO3/c18-15(11-6-1-2-7-12(11)16(19)20)13-9-17-14-8-4-3-5-10(13)14/h1-5,8-9,11-12,17H,6-7H2,(H,19,20)/p-1/t11-,12+/m1/s1 |
| InChIKey | GKBUBSSAMVENEJ-NEPJUHHUSA-M |
| XLogP | 1.68 |
| TPSA | 72.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|