C15H17N3O3 — CID 5454756
N-[(Z)-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]methylideneamino]-2-nitrobenzamide (PubChem CID 5454756) has the molecular formula C15H17N3O3 and a molecular weight of 287.32 g/mol. Its IUPAC name is N-[(Z)-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]methylideneamino]-2-nitrobenzamide.
| Compound Name | N-[(Z)-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]methylideneamino]-2-nitrobenzamide |
|---|---|
| PubChem CID | 5454756 |
| Molecular Formula | C15H17N3O3 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | N-[(Z)-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]methylideneamino]-2-nitrobenzamide |
| SMILES | O=C(N/N=C\[C@@H]1C[C@H]2CC[C@@H]1C2)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H17N3O3/c19-15(13-3-1-2-4-14(13)18(20)21)17-16-9-12-8-10-5-6-11(12)7-10/h1-4,9-12H,5-8H2,(H,17,19)/b16-9-/t10-,11+,12-/m0/s1 |
| InChIKey | CFPPWGPKIMBLIM-RKZMLFOCSA-N |
| XLogP | 2.75 |
| TPSA | 84.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|