C14H16N4O4 — CID 7302065
N-[(Z)-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]methylideneamino]-2,4-dinitroaniline (PubChem CID 7302065) has the molecular formula C14H16N4O4 and a molecular weight of 304.31 g/mol. Its IUPAC name is N-[(Z)-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]methylideneamino]-2,4-dinitroaniline.
| Compound Name | N-[(Z)-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]methylideneamino]-2,4-dinitroaniline |
|---|---|
| PubChem CID | 7302065 |
| Molecular Formula | C14H16N4O4 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | N-[(Z)-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]methylideneamino]-2,4-dinitroaniline |
| SMILES | O=[N+]([O-])c1ccc(N/N=C\[C@@H]2C[C@H]3CC[C@H]2C3)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H16N4O4/c19-17(20)12-3-4-13(14(7-12)18(21)22)16-15-8-11-6-9-1-2-10(11)5-9/h3-4,7-11,16H,1-2,5-6H2/b15-8-/t9-,10-,11-/m0/s1 |
| InChIKey | DDAXDTFFFWBTPX-UVMLIHPZSA-N |
| XLogP | 3.34 |
| TPSA | 110.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|