C16H20ClN3O4S — CID 11923508
5-[[[2-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]acetyl]amino]carbamoyl]-2-chlorobenzenesulfonamide (PubChem CID 11923508) has the molecular formula C16H20ClN3O4S and a molecular weight of 385.87 g/mol. Its IUPAC name is 5-[[[2-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]acetyl]amino]carbamoyl]-2-chlorobenzenesulfonamide.
| Compound Name | 5-[[[2-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]acetyl]amino]carbamoyl]-2-chlorobenzenesulfonamide |
|---|---|
| PubChem CID | 11923508 |
| Molecular Formula | C16H20ClN3O4S |
| Molecular Weight | 385.87 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | 5-[[[2-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]acetyl]amino]carbamoyl]-2-chlorobenzenesulfonamide |
| SMILES | NS(=O)(=O)c1cc(C(=O)NNC(=O)C[C@H]2C[C@H]3CC[C@@H]2C3)ccc1Cl |
| InChI | InChI=1S/C16H20ClN3O4S/c17-13-4-3-11(7-14(13)25(18,23)24)16(22)20-19-15(21)8-12-6-9-1-2-10(12)5-9/h3-4,7,9-10,12H,1-2,5-6,8H2,(H,19,21)(H,20,22)(H2,18,23,24)/t9-,10+,12+/m0/s1 |
| InChIKey | OLBVMAABYREGOD-HOSYDEDBSA-N |
| XLogP | 1.57 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.87 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|