C15H19N3O2 — CID 98605976
N'-[2-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]acetyl]pyridine-4-carbohydrazide (PubChem CID 98605976) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is N'-[2-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]acetyl]pyridine-4-carbohydrazide.
| Compound Name | N'-[2-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]acetyl]pyridine-4-carbohydrazide |
|---|---|
| PubChem CID | 98605976 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | N'-[2-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]acetyl]pyridine-4-carbohydrazide |
| SMILES | O=C(C[C@@H]1C[C@H]2CC[C@H]1C2)NNC(=O)c1ccncc1 |
| InChI | InChI=1S/C15H19N3O2/c19-14(9-13-8-10-1-2-12(13)7-10)17-18-15(20)11-3-5-16-6-4-11/h3-6,10,12-13H,1-2,7-9H2,(H,17,19)(H,18,20)/t10-,12-,13-/m0/s1 |
| InChIKey | FWWXVAJUKMEOGN-DRZSPHRISA-N |
| XLogP | 1.67 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|