C18H24N2O2 — CID 11906552
N'-[2-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]acetyl]-4-ethylbenzohydrazide (PubChem CID 11906552) has the molecular formula C18H24N2O2 and a molecular weight of 300.40 g/mol. Its IUPAC name is N'-[2-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]acetyl]-4-ethylbenzohydrazide.
| Compound Name | N'-[2-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]acetyl]-4-ethylbenzohydrazide |
|---|---|
| PubChem CID | 11906552 |
| Molecular Formula | C18H24N2O2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | N'-[2-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]acetyl]-4-ethylbenzohydrazide |
| SMILES | CCc1ccc(C(=O)NNC(=O)C[C@H]2C[C@H]3CC[C@@H]2C3)cc1 |
| InChI | InChI=1S/C18H24N2O2/c1-2-12-3-6-14(7-4-12)18(22)20-19-17(21)11-16-10-13-5-8-15(16)9-13/h3-4,6-7,13,15-16H,2,5,8-11H2,1H3,(H,19,21)(H,20,22)/t13-,15+,16+/m0/s1 |
| InChIKey | IDEPCGISEJRJSD-NUEKZKHPSA-N |
| XLogP | 2.84 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|