C21H29N3O4S — CID 11919734
N'-[2-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]acetyl]-3-piperidin-1-ylsulfonylbenzohydrazide (PubChem CID 11919734) has the molecular formula C21H29N3O4S and a molecular weight of 419.55 g/mol. Its IUPAC name is N'-[2-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]acetyl]-3-piperidin-1-ylsulfonylbenzohydrazide.
| Compound Name | N'-[2-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]acetyl]-3-piperidin-1-ylsulfonylbenzohydrazide |
|---|---|
| PubChem CID | 11919734 |
| Molecular Formula | C21H29N3O4S |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | N'-[2-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]acetyl]-3-piperidin-1-ylsulfonylbenzohydrazide |
| SMILES | O=C(C[C@H]1C[C@H]2CC[C@@H]1C2)NNC(=O)c1cccc(S(=O)(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C21H29N3O4S/c25-20(14-18-12-15-7-8-16(18)11-15)22-23-21(26)17-5-4-6-19(13-17)29(27,28)24-9-2-1-3-10-24/h4-6,13,15-16,18H,1-3,7-12,14H2,(H,22,25)(H,23,26)/t15-,16+,18+/m0/s1 |
| InChIKey | XPGQCIQTKHANAX-LZLYRXPVSA-N |
| XLogP | 2.45 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|