C14H15NO3 — CID 9037032
N-(1,3-benzodioxol-5-yl)-2-[(1S)-cyclopent-2-en-1-yl]acetamide (PubChem CID 9037032) has the molecular formula C14H15NO3 and a molecular weight of 245.28 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-[(1S)-cyclopent-2-en-1-yl]acetamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-[(1S)-cyclopent-2-en-1-yl]acetamide |
|---|---|
| PubChem CID | 9037032 |
| Molecular Formula | C14H15NO3 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-[(1S)-cyclopent-2-en-1-yl]acetamide |
| SMILES | O=C(C[C@H]1C=CCC1)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C14H15NO3/c16-14(7-10-3-1-2-4-10)15-11-5-6-12-13(8-11)18-9-17-12/h1,3,5-6,8,10H,2,4,7,9H2,(H,15,16)/t10-/m0/s1 |
| InChIKey | LHFRLAPAYMLCNP-JTQLQIEISA-N |
| XLogP | 2.71 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|