C14H15FN2O2 — CID 9038011
N'-[2-[(1R)-cyclopent-2-en-1-yl]acetyl]-4-fluorobenzohydrazide (PubChem CID 9038011) has the molecular formula C14H15FN2O2 and a molecular weight of 262.28 g/mol. Its IUPAC name is N'-[2-[(1R)-cyclopent-2-en-1-yl]acetyl]-4-fluorobenzohydrazide.
| Compound Name | N'-[2-[(1R)-cyclopent-2-en-1-yl]acetyl]-4-fluorobenzohydrazide |
|---|---|
| PubChem CID | 9038011 |
| Molecular Formula | C14H15FN2O2 |
| Molecular Weight | 262.28 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | N'-[2-[(1R)-cyclopent-2-en-1-yl]acetyl]-4-fluorobenzohydrazide |
| SMILES | O=C(C[C@@H]1C=CCC1)NNC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H15FN2O2/c15-12-7-5-11(6-8-12)14(19)17-16-13(18)9-10-3-1-2-4-10/h1,3,5-8,10H,2,4,9H2,(H,16,18)(H,17,19)/t10-/m1/s1 |
| InChIKey | AZHNKDLVUDWGSC-SNVBAGLBSA-N |
| XLogP | 1.94 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.28 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|