C17H21FN2O2 — CID 95583323
(2S)-2-[[[2-[(1S)-cyclopent-2-en-1-yl]acetyl]amino]methyl]-3-(4-fluorophenyl)propanamide (PubChem CID 95583323) has the molecular formula C17H21FN2O2 and a molecular weight of 304.37 g/mol. Its IUPAC name is (2S)-2-[[[2-[(1S)-cyclopent-2-en-1-yl]acetyl]amino]methyl]-3-(4-fluorophenyl)propanamide.
| Compound Name | (2S)-2-[[[2-[(1S)-cyclopent-2-en-1-yl]acetyl]amino]methyl]-3-(4-fluorophenyl)propanamide |
|---|---|
| PubChem CID | 95583323 |
| Molecular Formula | C17H21FN2O2 |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | (2S)-2-[[[2-[(1S)-cyclopent-2-en-1-yl]acetyl]amino]methyl]-3-(4-fluorophenyl)propanamide |
| SMILES | NC(=O)[C@H](CNC(=O)C[C@H]1C=CCC1)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C17H21FN2O2/c18-15-7-5-13(6-8-15)9-14(17(19)22)11-20-16(21)10-12-3-1-2-4-12/h1,3,5-8,12,14H,2,4,9-11H2,(H2,19,22)(H,20,21)/t12-,14-/m0/s1 |
| InChIKey | MMMFVWLJNPRIRM-JSGCOSHPSA-N |
| XLogP | 1.94 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|