C18H24FN3O3 — CID 60587594
N-[4-[[3-amino-2-[(4-fluorophenyl)methyl]-3-oxopropyl]amino]-4-oxobutyl]cyclopropanecarboxamide (PubChem CID 60587594) has the molecular formula C18H24FN3O3 and a molecular weight of 349.41 g/mol. Its IUPAC name is N-[4-[[3-amino-2-[(4-fluorophenyl)methyl]-3-oxopropyl]amino]-4-oxobutyl]cyclopropanecarboxamide.
| Compound Name | N-[4-[[3-amino-2-[(4-fluorophenyl)methyl]-3-oxopropyl]amino]-4-oxobutyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 60587594 |
| Molecular Formula | C18H24FN3O3 |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | N-[4-[[3-amino-2-[(4-fluorophenyl)methyl]-3-oxopropyl]amino]-4-oxobutyl]cyclopropanecarboxamide |
| SMILES | NC(=O)C(CNC(=O)CCCNC(=O)C1CC1)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C18H24FN3O3/c19-15-7-3-12(4-8-15)10-14(17(20)24)11-22-16(23)2-1-9-21-18(25)13-5-6-13/h3-4,7-8,13-14H,1-2,5-6,9-11H2,(H2,20,24)(H,21,25)(H,22,23) |
| InChIKey | OKDJOEOGDGMDGB-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|