C16H23FN4O — CID 111868264
2-[[[N-(cyclopropylmethyl)-N'-methylcarbamimidoyl]amino]methyl]-3-(4-fluorophenyl)propanamide (PubChem CID 111868264) has the molecular formula C16H23FN4O and a molecular weight of 306.38 g/mol. Its IUPAC name is 2-[[[N-(cyclopropylmethyl)-N'-methylcarbamimidoyl]amino]methyl]-3-(4-fluorophenyl)propanamide.
| Compound Name | 2-[[[N-(cyclopropylmethyl)-N'-methylcarbamimidoyl]amino]methyl]-3-(4-fluorophenyl)propanamide |
|---|---|
| PubChem CID | 111868264 |
| Molecular Formula | C16H23FN4O |
| Molecular Weight | 306.38 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | 2-[[[N-(cyclopropylmethyl)-N'-methylcarbamimidoyl]amino]methyl]-3-(4-fluorophenyl)propanamide |
| SMILES | C/N=C(\NCC1CC1)NCC(Cc1ccc(F)cc1)C(N)=O |
| InChI | InChI=1S/C16H23FN4O/c1-19-16(20-9-12-2-3-12)21-10-13(15(18)22)8-11-4-6-14(17)7-5-11/h4-7,12-13H,2-3,8-10H2,1H3,(H2,18,22)(H2,19,20,21) |
| InChIKey | GASVJMDRISUKAN-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.38 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|