C20H31FN4O2S — CID 109439649
2-[[[N-(3-ethylsulfinylcyclohexyl)-N'-methylcarbamimidoyl]amino]methyl]-3-(4-fluorophenyl)propanamide (PubChem CID 109439649) has the molecular formula C20H31FN4O2S and a molecular weight of 410.56 g/mol. Its IUPAC name is 2-[[[N-(3-ethylsulfinylcyclohexyl)-N'-methylcarbamimidoyl]amino]methyl]-3-(4-fluorophenyl)propanamide.
| Compound Name | 2-[[[N-(3-ethylsulfinylcyclohexyl)-N'-methylcarbamimidoyl]amino]methyl]-3-(4-fluorophenyl)propanamide |
|---|---|
| PubChem CID | 109439649 |
| Molecular Formula | C20H31FN4O2S |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | 2-[[[N-(3-ethylsulfinylcyclohexyl)-N'-methylcarbamimidoyl]amino]methyl]-3-(4-fluorophenyl)propanamide |
| SMILES | CCS(=O)C1CCCC(N/C(=N/C)NCC(Cc2ccc(F)cc2)C(N)=O)C1 |
| InChI | InChI=1S/C20H31FN4O2S/c1-3-28(27)18-6-4-5-17(12-18)25-20(23-2)24-13-15(19(22)26)11-14-7-9-16(21)10-8-14/h7-10,15,17-18H,3-6,11-13H2,1-2H3,(H2,22,26)(H2,23,24,25) |
| InChIKey | PWUNXQKARVTFBP-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|