C23H33FIN5OS — CID 111666167
2-[(4-fluorophenyl)methyl]-3-[[N'-methyl-N-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]carbamimidoyl]amino]propanamide;hydroiodide (PubChem CID 111666167) has the molecular formula C23H33FIN5OS and a molecular weight of 573.52 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methyl]-3-[[N'-methyl-N-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]carbamimidoyl]amino]propanamide;hydroiodide.
| Compound Name | 2-[(4-fluorophenyl)methyl]-3-[[N'-methyl-N-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]carbamimidoyl]amino]propanamide;hydroiodide |
|---|---|
| PubChem CID | 111666167 |
| Molecular Formula | C23H33FIN5OS |
| Molecular Weight | 573.52 g/mol |
| Exact Mass | 573.14 |
| IUPAC Name | 2-[(4-fluorophenyl)methyl]-3-[[N'-methyl-N-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]carbamimidoyl]amino]propanamide;hydroiodide |
| SMILES | C/N=C(\NCC(Cc1ccc(F)cc1)C(N)=O)NCC1CCCN(C)C1c1cccs1.I |
| InChI | InChI=1S/C23H32FN5OS.HI/c1-26-23(28-15-18(22(25)30)13-16-7-9-19(24)10-8-16)27-14-17-5-3-11-29(2)21(17)20-6-4-12-31-20;/h4,6-10,12,17-18,21H,3,5,11,13-15H2,1-2H3,(H2,25,30)(H2,26,27,28);1H |
| InChIKey | ZTUWPVQXUUNFKH-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.52 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|