C23H32FN5OS — CID 111666930
3-fluoro-4-methyl-N-[2-[[N'-methyl-N-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]carbamimidoyl]amino]ethyl]benzamide (PubChem CID 111666930) has the molecular formula C23H32FN5OS and a molecular weight of 445.61 g/mol. Its IUPAC name is 3-fluoro-4-methyl-N-[2-[[N'-methyl-N-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]carbamimidoyl]amino]ethyl]benzamide.
| Compound Name | 3-fluoro-4-methyl-N-[2-[[N'-methyl-N-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]carbamimidoyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 111666930 |
| Molecular Formula | C23H32FN5OS |
| Molecular Weight | 445.61 g/mol |
| Exact Mass | 445.23 |
| IUPAC Name | 3-fluoro-4-methyl-N-[2-[[N'-methyl-N-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]carbamimidoyl]amino]ethyl]benzamide |
| SMILES | C/N=C(\NCCNC(=O)c1ccc(C)c(F)c1)NCC1CCCN(C)C1c1cccs1 |
| InChI | InChI=1S/C23H32FN5OS/c1-16-8-9-17(14-19(16)24)22(30)26-10-11-27-23(25-2)28-15-18-6-4-12-29(3)21(18)20-7-5-13-31-20/h5,7-9,13-14,18,21H,4,6,10-12,15H2,1-3H3,(H,26,30)(H2,25,27,28) |
| InChIKey | JZADJOQBIXWYRH-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.61 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|