C22H32N6OS — CID 111666022
3-[[N'-methyl-N-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]carbamimidoyl]amino]-N-(5-methyl-2-pyridinyl)propanamide (PubChem CID 111666022) has the molecular formula C22H32N6OS and a molecular weight of 428.61 g/mol. Its IUPAC name is 3-[[N'-methyl-N-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]carbamimidoyl]amino]-N-(5-methyl-2-pyridinyl)propanamide.
| Compound Name | 3-[[N'-methyl-N-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]carbamimidoyl]amino]-N-(5-methyl-2-pyridinyl)propanamide |
|---|---|
| PubChem CID | 111666022 |
| Molecular Formula | C22H32N6OS |
| Molecular Weight | 428.61 g/mol |
| Exact Mass | 428.24 |
| IUPAC Name | 3-[[N'-methyl-N-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]carbamimidoyl]amino]-N-(5-methyl-2-pyridinyl)propanamide |
| SMILES | C/N=C(\NCCC(=O)Nc1ccc(C)cn1)NCC1CCCN(C)C1c1cccs1 |
| InChI | InChI=1S/C22H32N6OS/c1-16-8-9-19(25-14-16)27-20(29)10-11-24-22(23-2)26-15-17-6-4-12-28(3)21(17)18-7-5-13-30-18/h5,7-9,13-14,17,21H,4,6,10-12,15H2,1-3H3,(H2,23,24,26)(H,25,27,29) |
| InChIKey | GLTULTIRAZJYBN-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.61 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|