C21H34IN5S2 — CID 111667011
1-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-2-methyl-3-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]guanidine;hydroiodide (PubChem CID 111667011) has the molecular formula C21H34IN5S2 and a molecular weight of 547.58 g/mol. Its IUPAC name is 1-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-2-methyl-3-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-2-methyl-3-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111667011 |
| Molecular Formula | C21H34IN5S2 |
| Molecular Weight | 547.58 g/mol |
| Exact Mass | 547.13 |
| IUPAC Name | 1-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-2-methyl-3-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]guanidine;hydroiodide |
| SMILES | CCc1nc(CCN/C(=N\C)NCC2CCCN(C)C2c2cccs2)sc1C.I |
| InChI | InChI=1S/C21H33N5S2.HI/c1-5-17-15(2)28-19(25-17)10-11-23-21(22-3)24-14-16-8-6-12-26(4)20(16)18-9-7-13-27-18;/h7,9,13,16,20H,5-6,8,10-12,14H2,1-4H3,(H2,22,23,24);1H |
| InChIKey | ZYLZIFGQQQOHRJ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.58 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|