C20H33IN6S — CID 119153631
2-methyl-1-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 119153631) has the molecular formula C20H33IN6S and a molecular weight of 516.50 g/mol. Its IUPAC name is 2-methyl-1-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 119153631 |
| Molecular Formula | C20H33IN6S |
| Molecular Weight | 516.50 g/mol |
| Exact Mass | 516.15 |
| IUPAC Name | 2-methyl-1-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1c(C)nn(C)c1C)NCC1CCCN(C)C1c1cccs1.I |
| InChI | InChI=1S/C20H32N6S.HI/c1-14-17(15(2)26(5)24-14)13-23-20(21-3)22-12-16-8-6-10-25(4)19(16)18-9-7-11-27-18;/h7,9,11,16,19H,6,8,10,12-13H2,1-5H3,(H2,21,22,23);1H |
| InChIKey | AZUKGQLYFYSLDA-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 57.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.50 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|