C18H26BrIN4S2 — CID 111666837
1-[(4-bromothiophen-2-yl)methyl]-2-methyl-3-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]guanidine;hydroiodide (PubChem CID 111666837) has the molecular formula C18H26BrIN4S2 and a molecular weight of 569.38 g/mol. Its IUPAC name is 1-[(4-bromothiophen-2-yl)methyl]-2-methyl-3-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[(4-bromothiophen-2-yl)methyl]-2-methyl-3-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111666837 |
| Molecular Formula | C18H26BrIN4S2 |
| Molecular Weight | 569.38 g/mol |
| Exact Mass | 567.98 |
| IUPAC Name | 1-[(4-bromothiophen-2-yl)methyl]-2-methyl-3-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1cc(Br)cs1)NCC1CCCN(C)C1c1cccs1.I |
| InChI | InChI=1S/C18H25BrN4S2.HI/c1-20-18(22-11-15-9-14(19)12-25-15)21-10-13-5-3-7-23(2)17(13)16-6-4-8-24-16;/h4,6,8-9,12-13,17H,3,5,7,10-11H2,1-2H3,(H2,20,21,22);1H |
| InChIKey | CHVXSVHEFPWXJK-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.38 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|