C24H37IN6S — CID 111666079
2-methyl-1-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]-3-[(2-piperidin-1-yl-4-pyridinyl)methyl]guanidine;hydroiodide (PubChem CID 111666079) has the molecular formula C24H37IN6S and a molecular weight of 568.57 g/mol. Its IUPAC name is 2-methyl-1-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]-3-[(2-piperidin-1-yl-4-pyridinyl)methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]-3-[(2-piperidin-1-yl-4-pyridinyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111666079 |
| Molecular Formula | C24H37IN6S |
| Molecular Weight | 568.57 g/mol |
| Exact Mass | 568.18 |
| IUPAC Name | 2-methyl-1-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]-3-[(2-piperidin-1-yl-4-pyridinyl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ccnc(N2CCCCC2)c1)NCC1CCCN(C)C1c1cccs1.I |
| InChI | InChI=1S/C24H36N6S.HI/c1-25-24(27-17-19-10-11-26-22(16-19)30-13-4-3-5-14-30)28-18-20-8-6-12-29(2)23(20)21-9-7-15-31-21;/h7,9-11,15-16,20,23H,3-6,8,12-14,17-18H2,1-2H3,(H2,25,27,28);1H |
| InChIKey | FOBXKKWSXQJRQD-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 55.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.57 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|