C23H31IN6S — CID 111666577
2-methyl-1-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]-3-[(5-phenyl-1H-imidazol-2-yl)methyl]guanidine;hydroiodide (PubChem CID 111666577) has the molecular formula C23H31IN6S and a molecular weight of 550.51 g/mol. Its IUPAC name is 2-methyl-1-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]-3-[(5-phenyl-1H-imidazol-2-yl)methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]-3-[(5-phenyl-1H-imidazol-2-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111666577 |
| Molecular Formula | C23H31IN6S |
| Molecular Weight | 550.51 g/mol |
| Exact Mass | 550.14 |
| IUPAC Name | 2-methyl-1-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]-3-[(5-phenyl-1H-imidazol-2-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ncc(-c2ccccc2)[nH]1)NCC1CCCN(C)C1c1cccs1.I |
| InChI | InChI=1S/C23H30N6S.HI/c1-24-23(27-16-21-25-15-19(28-21)17-8-4-3-5-9-17)26-14-18-10-6-12-29(2)22(18)20-11-7-13-30-20;/h3-5,7-9,11,13,15,18,22H,6,10,12,14,16H2,1-2H3,(H,25,28)(H2,24,26,27);1H |
| InChIKey | MYLKDDGMGCIJOM-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 68.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.51 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|