C17H20IN5S — CID 111259956
2-methyl-1-[(5-phenyl-1H-imidazol-2-yl)methyl]-3-(thiophen-2-ylmethyl)guanidine;hydroiodide (PubChem CID 111259956) has the molecular formula C17H20IN5S and a molecular weight of 453.35 g/mol. Its IUPAC name is 2-methyl-1-[(5-phenyl-1H-imidazol-2-yl)methyl]-3-(thiophen-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[(5-phenyl-1H-imidazol-2-yl)methyl]-3-(thiophen-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111259956 |
| Molecular Formula | C17H20IN5S |
| Molecular Weight | 453.35 g/mol |
| Exact Mass | 453.05 |
| IUPAC Name | 2-methyl-1-[(5-phenyl-1H-imidazol-2-yl)methyl]-3-(thiophen-2-ylmethyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ncc(-c2ccccc2)[nH]1)NCc1cccs1.I |
| InChI | InChI=1S/C17H19N5S.HI/c1-18-17(20-10-14-8-5-9-23-14)21-12-16-19-11-15(22-16)13-6-3-2-4-7-13;/h2-9,11H,10,12H2,1H3,(H,19,22)(H2,18,20,21);1H |
| InChIKey | AKHCMXKTLIDVOW-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.35 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|