C20H21F3IN5 — CID 111420412
2-methyl-1-[(5-phenyl-1H-imidazol-2-yl)methyl]-3-[[4-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111420412) has the molecular formula C20H21F3IN5 and a molecular weight of 515.32 g/mol. Its IUPAC name is 2-methyl-1-[(5-phenyl-1H-imidazol-2-yl)methyl]-3-[[4-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[(5-phenyl-1H-imidazol-2-yl)methyl]-3-[[4-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111420412 |
| Molecular Formula | C20H21F3IN5 |
| Molecular Weight | 515.32 g/mol |
| Exact Mass | 515.08 |
| IUPAC Name | 2-methyl-1-[(5-phenyl-1H-imidazol-2-yl)methyl]-3-[[4-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(C(F)(F)F)cc1)NCc1ncc(-c2ccccc2)[nH]1.I |
| InChI | InChI=1S/C20H20F3N5.HI/c1-24-19(26-11-14-7-9-16(10-8-14)20(21,22)23)27-13-18-25-12-17(28-18)15-5-3-2-4-6-15;/h2-10,12H,11,13H2,1H3,(H,25,28)(H2,24,26,27);1H |
| InChIKey | LIEUPPXQXIUFPU-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.32 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|