C18H21N5S — CID 111349764
2-methyl-1-[(5-phenyl-1H-imidazol-2-yl)methyl]-3-(2-thiophen-2-ylethyl)guanidine (PubChem CID 111349764) has the molecular formula C18H21N5S and a molecular weight of 339.47 g/mol. Its IUPAC name is 2-methyl-1-[(5-phenyl-1H-imidazol-2-yl)methyl]-3-(2-thiophen-2-ylethyl)guanidine.
| Compound Name | 2-methyl-1-[(5-phenyl-1H-imidazol-2-yl)methyl]-3-(2-thiophen-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111349764 |
| Molecular Formula | C18H21N5S |
| Molecular Weight | 339.47 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | 2-methyl-1-[(5-phenyl-1H-imidazol-2-yl)methyl]-3-(2-thiophen-2-ylethyl)guanidine |
| SMILES | C/N=C(\NCCc1cccs1)NCc1ncc(-c2ccccc2)[nH]1 |
| InChI | InChI=1S/C18H21N5S/c1-19-18(20-10-9-15-8-5-11-24-15)22-13-17-21-12-16(23-17)14-6-3-2-4-7-14/h2-8,11-12H,9-10,13H2,1H3,(H,21,23)(H2,19,20,22) |
| InChIKey | ISIMXSBDGNABHV-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.47 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|