C23H40IN5OS — CID 111666751
2-cyclohexyl-N-[2-[[N'-methyl-N-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]carbamimidoyl]amino]ethyl]acetamide;hydroiodide (PubChem CID 111666751) has the molecular formula C23H40IN5OS and a molecular weight of 561.58 g/mol. Its IUPAC name is 2-cyclohexyl-N-[2-[[N'-methyl-N-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]carbamimidoyl]amino]ethyl]acetamide;hydroiodide.
| Compound Name | 2-cyclohexyl-N-[2-[[N'-methyl-N-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]carbamimidoyl]amino]ethyl]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111666751 |
| Molecular Formula | C23H40IN5OS |
| Molecular Weight | 561.58 g/mol |
| Exact Mass | 561.20 |
| IUPAC Name | 2-cyclohexyl-N-[2-[[N'-methyl-N-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]carbamimidoyl]amino]ethyl]acetamide;hydroiodide |
| SMILES | C/N=C(\NCCNC(=O)CC1CCCCC1)NCC1CCCN(C)C1c1cccs1.I |
| InChI | InChI=1S/C23H39N5OS.HI/c1-24-23(26-13-12-25-21(29)16-18-8-4-3-5-9-18)27-17-19-10-6-14-28(2)22(19)20-11-7-15-30-20;/h7,11,15,18-19,22H,3-6,8-10,12-14,16-17H2,1-2H3,(H,25,29)(H2,24,26,27);1H |
| InChIKey | AQRZWMNLXPTKOO-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.58 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|