C20H31N5S2 — CID 111667022
2-methyl-1-[3-(4-methyl-1,3-thiazol-2-yl)propyl]-3-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]guanidine (PubChem CID 111667022) has the molecular formula C20H31N5S2 and a molecular weight of 405.64 g/mol. Its IUPAC name is 2-methyl-1-[3-(4-methyl-1,3-thiazol-2-yl)propyl]-3-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]guanidine.
| Compound Name | 2-methyl-1-[3-(4-methyl-1,3-thiazol-2-yl)propyl]-3-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111667022 |
| Molecular Formula | C20H31N5S2 |
| Molecular Weight | 405.64 g/mol |
| Exact Mass | 405.20 |
| IUPAC Name | 2-methyl-1-[3-(4-methyl-1,3-thiazol-2-yl)propyl]-3-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]guanidine |
| SMILES | C/N=C(\NCCCc1nc(C)cs1)NCC1CCCN(C)C1c1cccs1 |
| InChI | InChI=1S/C20H31N5S2/c1-15-14-27-18(24-15)9-4-10-22-20(21-2)23-13-16-7-5-11-25(3)19(16)17-8-6-12-26-17/h6,8,12,14,16,19H,4-5,7,9-11,13H2,1-3H3,(H2,21,22,23) |
| InChIKey | XGDFLJCQCYVVDD-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.64 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|