C23H36IN5S2 — CID 111666009
2-methyl-1-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]-3-[3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)propyl]guanidine;hydroiodide (PubChem CID 111666009) has the molecular formula C23H36IN5S2 and a molecular weight of 573.61 g/mol. Its IUPAC name is 2-methyl-1-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]-3-[3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)propyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]-3-[3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111666009 |
| Molecular Formula | C23H36IN5S2 |
| Molecular Weight | 573.61 g/mol |
| Exact Mass | 573.15 |
| IUPAC Name | 2-methyl-1-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]-3-[3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)propyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCCc1nc2c(s1)CCCC2)NCC1CCCN(C)C1c1cccs1.I |
| InChI | InChI=1S/C23H35N5S2.HI/c1-24-23(25-13-5-12-21-27-18-9-3-4-10-19(18)30-21)26-16-17-8-6-14-28(2)22(17)20-11-7-15-29-20;/h7,11,15,17,22H,3-6,8-10,12-14,16H2,1-2H3,(H2,24,25,26);1H |
| InChIKey | RNWWMZGEJVDLFR-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.61 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|