C24H33FIN5O — CID 111326531
2-[(4-fluorophenyl)methyl]-3-[[N'-methyl-N-(2-phenyl-2-pyrrolidin-1-ylethyl)carbamimidoyl]amino]propanamide;hydroiodide (PubChem CID 111326531) has the molecular formula C24H33FIN5O and a molecular weight of 553.46 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methyl]-3-[[N'-methyl-N-(2-phenyl-2-pyrrolidin-1-ylethyl)carbamimidoyl]amino]propanamide;hydroiodide.
| Compound Name | 2-[(4-fluorophenyl)methyl]-3-[[N'-methyl-N-(2-phenyl-2-pyrrolidin-1-ylethyl)carbamimidoyl]amino]propanamide;hydroiodide |
|---|---|
| PubChem CID | 111326531 |
| Molecular Formula | C24H33FIN5O |
| Molecular Weight | 553.46 g/mol |
| Exact Mass | 553.17 |
| IUPAC Name | 2-[(4-fluorophenyl)methyl]-3-[[N'-methyl-N-(2-phenyl-2-pyrrolidin-1-ylethyl)carbamimidoyl]amino]propanamide;hydroiodide |
| SMILES | C/N=C(/NCC(Cc1ccc(F)cc1)C(N)=O)NCC(c1ccccc1)N1CCCC1.I |
| InChI | InChI=1S/C24H32FN5O.HI/c1-27-24(28-16-20(23(26)31)15-18-9-11-21(25)12-10-18)29-17-22(30-13-5-6-14-30)19-7-3-2-4-8-19;/h2-4,7-12,20,22H,5-6,13-17H2,1H3,(H2,26,31)(H2,27,28,29);1H |
| InChIKey | KHRKEKZZTJKIBA-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.46 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|