C25H35FIN5O — CID 111411972
2-[(4-fluorophenyl)methyl]-3-[[N'-methyl-N-[[4-(piperidin-1-ylmethyl)phenyl]methyl]carbamimidoyl]amino]propanamide;hydroiodide (PubChem CID 111411972) has the molecular formula C25H35FIN5O and a molecular weight of 567.49 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methyl]-3-[[N'-methyl-N-[[4-(piperidin-1-ylmethyl)phenyl]methyl]carbamimidoyl]amino]propanamide;hydroiodide.
| Compound Name | 2-[(4-fluorophenyl)methyl]-3-[[N'-methyl-N-[[4-(piperidin-1-ylmethyl)phenyl]methyl]carbamimidoyl]amino]propanamide;hydroiodide |
|---|---|
| PubChem CID | 111411972 |
| Molecular Formula | C25H35FIN5O |
| Molecular Weight | 567.49 g/mol |
| Exact Mass | 567.19 |
| IUPAC Name | 2-[(4-fluorophenyl)methyl]-3-[[N'-methyl-N-[[4-(piperidin-1-ylmethyl)phenyl]methyl]carbamimidoyl]amino]propanamide;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(CN2CCCCC2)cc1)NCC(Cc1ccc(F)cc1)C(N)=O.I |
| InChI | InChI=1S/C25H34FN5O.HI/c1-28-25(30-17-22(24(27)32)15-19-9-11-23(26)12-10-19)29-16-20-5-7-21(8-6-20)18-31-13-3-2-4-14-31;/h5-12,22H,2-4,13-18H2,1H3,(H2,27,32)(H2,28,29,30);1H |
| InChIKey | LBTPCMRIYJYDHC-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.49 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|