C19H22Cl2FIN4O — CID 111198111
2-[[[N-[(2,4-dichlorophenyl)methyl]-N'-methylcarbamimidoyl]amino]methyl]-3-(4-fluorophenyl)propanamide;hydroiodide (PubChem CID 111198111) has the molecular formula C19H22Cl2FIN4O and a molecular weight of 539.22 g/mol. Its IUPAC name is 2-[[[N-[(2,4-dichlorophenyl)methyl]-N'-methylcarbamimidoyl]amino]methyl]-3-(4-fluorophenyl)propanamide;hydroiodide.
| Compound Name | 2-[[[N-[(2,4-dichlorophenyl)methyl]-N'-methylcarbamimidoyl]amino]methyl]-3-(4-fluorophenyl)propanamide;hydroiodide |
|---|---|
| PubChem CID | 111198111 |
| Molecular Formula | C19H22Cl2FIN4O |
| Molecular Weight | 539.22 g/mol |
| Exact Mass | 538.02 |
| IUPAC Name | 2-[[[N-[(2,4-dichlorophenyl)methyl]-N'-methylcarbamimidoyl]amino]methyl]-3-(4-fluorophenyl)propanamide;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(Cl)cc1Cl)NCC(Cc1ccc(F)cc1)C(N)=O.I |
| InChI | InChI=1S/C19H21Cl2FN4O.HI/c1-24-19(25-10-13-4-5-15(20)9-17(13)21)26-11-14(18(23)27)8-12-2-6-16(22)7-3-12;/h2-7,9,14H,8,10-11H2,1H3,(H2,23,27)(H2,24,25,26);1H |
| InChIKey | BZPORGKCKWYNPA-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.22 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|