C10H14Cl2IN3 — CID 110893037
1-[(2,4-dichlorophenyl)methyl]-2,3-dimethylguanidine;hydroiodide (PubChem CID 110893037) has the molecular formula C10H14Cl2IN3 and a molecular weight of 374.05 g/mol. Its IUPAC name is 1-[(2,4-dichlorophenyl)methyl]-2,3-dimethylguanidine;hydroiodide.
| Compound Name | 1-[(2,4-dichlorophenyl)methyl]-2,3-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110893037 |
| Molecular Formula | C10H14Cl2IN3 |
| Molecular Weight | 374.05 g/mol |
| Exact Mass | 372.96 |
| IUPAC Name | 1-[(2,4-dichlorophenyl)methyl]-2,3-dimethylguanidine;hydroiodide |
| SMILES | C/N=C(\NC)NCc1ccc(Cl)cc1Cl.I |
| InChI | InChI=1S/C10H13Cl2N3.HI/c1-13-10(14-2)15-6-7-3-4-8(11)5-9(7)12;/h3-5H,6H2,1-2H3,(H2,13,14,15);1H |
| InChIKey | ZRVQIQVCFGCCNF-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.05 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|