C14H23Cl2IN4 — CID 111197463
1-[(2,4-dichlorophenyl)methyl]-3-[2-[ethyl(methyl)amino]ethyl]-2-methylguanidine;hydroiodide (PubChem CID 111197463) has the molecular formula C14H23Cl2IN4 and a molecular weight of 445.18 g/mol. Its IUPAC name is 1-[(2,4-dichlorophenyl)methyl]-3-[2-[ethyl(methyl)amino]ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[(2,4-dichlorophenyl)methyl]-3-[2-[ethyl(methyl)amino]ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111197463 |
| Molecular Formula | C14H23Cl2IN4 |
| Molecular Weight | 445.18 g/mol |
| Exact Mass | 444.03 |
| IUPAC Name | 1-[(2,4-dichlorophenyl)methyl]-3-[2-[ethyl(methyl)amino]ethyl]-2-methylguanidine;hydroiodide |
| SMILES | CCN(C)CCN/C(=N\C)NCc1ccc(Cl)cc1Cl.I |
| InChI | InChI=1S/C14H22Cl2N4.HI/c1-4-20(3)8-7-18-14(17-2)19-10-11-5-6-12(15)9-13(11)16;/h5-6,9H,4,7-8,10H2,1-3H3,(H2,17,18,19);1H |
| InChIKey | WQPHWSCUUCGOPC-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.18 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|