C15H24Cl2N4 — CID 111197818
1-[(2,4-dichlorophenyl)methyl]-3-[2-(dimethylamino)-2-methylpropyl]-2-methylguanidine (PubChem CID 111197818) has the molecular formula C15H24Cl2N4 and a molecular weight of 331.29 g/mol. Its IUPAC name is 1-[(2,4-dichlorophenyl)methyl]-3-[2-(dimethylamino)-2-methylpropyl]-2-methylguanidine.
| Compound Name | 1-[(2,4-dichlorophenyl)methyl]-3-[2-(dimethylamino)-2-methylpropyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111197818 |
| Molecular Formula | C15H24Cl2N4 |
| Molecular Weight | 331.29 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | 1-[(2,4-dichlorophenyl)methyl]-3-[2-(dimethylamino)-2-methylpropyl]-2-methylguanidine |
| SMILES | C/N=C(/NCc1ccc(Cl)cc1Cl)NCC(C)(C)N(C)C |
| InChI | InChI=1S/C15H24Cl2N4/c1-15(2,21(4)5)10-20-14(18-3)19-9-11-6-7-12(16)8-13(11)17/h6-8H,9-10H2,1-5H3,(H2,18,19,20) |
| InChIKey | SRSAFGKGSYWFPI-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.29 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|