C16H24Cl2N4 — CID 111197586
1-[2-cyclopropyl-2-(dimethylamino)ethyl]-3-[(2,4-dichlorophenyl)methyl]-2-methylguanidine (PubChem CID 111197586) has the molecular formula C16H24Cl2N4 and a molecular weight of 343.30 g/mol. Its IUPAC name is 1-[2-cyclopropyl-2-(dimethylamino)ethyl]-3-[(2,4-dichlorophenyl)methyl]-2-methylguanidine.
| Compound Name | 1-[2-cyclopropyl-2-(dimethylamino)ethyl]-3-[(2,4-dichlorophenyl)methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111197586 |
| Molecular Formula | C16H24Cl2N4 |
| Molecular Weight | 343.30 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | 1-[2-cyclopropyl-2-(dimethylamino)ethyl]-3-[(2,4-dichlorophenyl)methyl]-2-methylguanidine |
| SMILES | C/N=C(/NCc1ccc(Cl)cc1Cl)NCC(C1CC1)N(C)C |
| InChI | InChI=1S/C16H24Cl2N4/c1-19-16(21-10-15(22(2)3)11-4-5-11)20-9-12-6-7-13(17)8-14(12)18/h6-8,11,15H,4-5,9-10H2,1-3H3,(H2,19,20,21) |
| InChIKey | XIUZHRWMBZTYKT-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.30 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|