C17H25Cl2IN6 — CID 111793411
1-[(2,4-dichlorophenyl)methyl]-3-[2-(dimethylamino)-2-(1-methylpyrazol-4-yl)ethyl]-2-methylguanidine;hydroiodide (PubChem CID 111793411) has the molecular formula C17H25Cl2IN6 and a molecular weight of 511.24 g/mol. Its IUPAC name is 1-[(2,4-dichlorophenyl)methyl]-3-[2-(dimethylamino)-2-(1-methylpyrazol-4-yl)ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[(2,4-dichlorophenyl)methyl]-3-[2-(dimethylamino)-2-(1-methylpyrazol-4-yl)ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111793411 |
| Molecular Formula | C17H25Cl2IN6 |
| Molecular Weight | 511.24 g/mol |
| Exact Mass | 510.06 |
| IUPAC Name | 1-[(2,4-dichlorophenyl)methyl]-3-[2-(dimethylamino)-2-(1-methylpyrazol-4-yl)ethyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(Cl)cc1Cl)NCC(c1cnn(C)c1)N(C)C.I |
| InChI | InChI=1S/C17H24Cl2N6.HI/c1-20-17(21-8-12-5-6-14(18)7-15(12)19)22-10-16(24(2)3)13-9-23-25(4)11-13;/h5-7,9,11,16H,8,10H2,1-4H3,(H2,20,21,22);1H |
| InChIKey | ADSXIWAKXGMTPR-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 57.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.24 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|