C17H25FN6 — CID 111794999
1-[2-(dimethylamino)-2-(1-methylpyrazol-4-yl)ethyl]-3-[(2-fluorophenyl)methyl]-2-methylguanidine (PubChem CID 111794999) has the molecular formula C17H25FN6 and a molecular weight of 332.43 g/mol. Its IUPAC name is 1-[2-(dimethylamino)-2-(1-methylpyrazol-4-yl)ethyl]-3-[(2-fluorophenyl)methyl]-2-methylguanidine.
| Compound Name | 1-[2-(dimethylamino)-2-(1-methylpyrazol-4-yl)ethyl]-3-[(2-fluorophenyl)methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111794999 |
| Molecular Formula | C17H25FN6 |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | 1-[2-(dimethylamino)-2-(1-methylpyrazol-4-yl)ethyl]-3-[(2-fluorophenyl)methyl]-2-methylguanidine |
| SMILES | C/N=C(/NCc1ccccc1F)NCC(c1cnn(C)c1)N(C)C |
| InChI | InChI=1S/C17H25FN6/c1-19-17(20-9-13-7-5-6-8-15(13)18)21-11-16(23(2)3)14-10-22-24(4)12-14/h5-8,10,12,16H,9,11H2,1-4H3,(H2,19,20,21) |
| InChIKey | QYQLFQBGLKHSLT-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 57.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|