C18H27ClN6S — CID 111797078
1-[2-(4-chlorophenyl)sulfanylethyl]-3-[2-(dimethylamino)-2-(1-methylpyrazol-4-yl)ethyl]-2-methylguanidine (PubChem CID 111797078) has the molecular formula C18H27ClN6S and a molecular weight of 394.98 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)sulfanylethyl]-3-[2-(dimethylamino)-2-(1-methylpyrazol-4-yl)ethyl]-2-methylguanidine.
| Compound Name | 1-[2-(4-chlorophenyl)sulfanylethyl]-3-[2-(dimethylamino)-2-(1-methylpyrazol-4-yl)ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111797078 |
| Molecular Formula | C18H27ClN6S |
| Molecular Weight | 394.98 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | 1-[2-(4-chlorophenyl)sulfanylethyl]-3-[2-(dimethylamino)-2-(1-methylpyrazol-4-yl)ethyl]-2-methylguanidine |
| SMILES | C/N=C(/NCCSc1ccc(Cl)cc1)NCC(c1cnn(C)c1)N(C)C |
| InChI | InChI=1S/C18H27ClN6S/c1-20-18(21-9-10-26-16-7-5-15(19)6-8-16)22-12-17(24(2)3)14-11-23-25(4)13-14/h5-8,11,13,17H,9-10,12H2,1-4H3,(H2,20,21,22) |
| InChIKey | MUYYQWUHXIJPKR-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 57.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.98 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|