C18H33IN6 — CID 111793716
1-[2-(cyclohexen-1-yl)ethyl]-3-[2-(dimethylamino)-2-(1-methylpyrazol-4-yl)ethyl]-2-methylguanidine;hydroiodide (PubChem CID 111793716) has the molecular formula C18H33IN6 and a molecular weight of 460.41 g/mol. Its IUPAC name is 1-[2-(cyclohexen-1-yl)ethyl]-3-[2-(dimethylamino)-2-(1-methylpyrazol-4-yl)ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(cyclohexen-1-yl)ethyl]-3-[2-(dimethylamino)-2-(1-methylpyrazol-4-yl)ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111793716 |
| Molecular Formula | C18H33IN6 |
| Molecular Weight | 460.41 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | 1-[2-(cyclohexen-1-yl)ethyl]-3-[2-(dimethylamino)-2-(1-methylpyrazol-4-yl)ethyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCCC1=CCCCC1)NCC(c1cnn(C)c1)N(C)C.I |
| InChI | InChI=1S/C18H32N6.HI/c1-19-18(20-11-10-15-8-6-5-7-9-15)21-13-17(23(2)3)16-12-22-24(4)14-16;/h8,12,14,17H,5-7,9-11,13H2,1-4H3,(H2,19,20,21);1H |
| InChIKey | ROSVUATZDJCVIK-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 57.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.41 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|