C15H19Cl2N5 — CID 111762653
1-[(2,4-dichlorophenyl)methyl]-2-methyl-3-[2-(4-methylpyrazol-1-yl)ethyl]guanidine (PubChem CID 111762653) has the molecular formula C15H19Cl2N5 and a molecular weight of 340.26 g/mol. Its IUPAC name is 1-[(2,4-dichlorophenyl)methyl]-2-methyl-3-[2-(4-methylpyrazol-1-yl)ethyl]guanidine.
| Compound Name | 1-[(2,4-dichlorophenyl)methyl]-2-methyl-3-[2-(4-methylpyrazol-1-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111762653 |
| Molecular Formula | C15H19Cl2N5 |
| Molecular Weight | 340.26 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | 1-[(2,4-dichlorophenyl)methyl]-2-methyl-3-[2-(4-methylpyrazol-1-yl)ethyl]guanidine |
| SMILES | C/N=C(\NCCn1cc(C)cn1)NCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H19Cl2N5/c1-11-8-21-22(10-11)6-5-19-15(18-2)20-9-12-3-4-13(16)7-14(12)17/h3-4,7-8,10H,5-6,9H2,1-2H3,(H2,18,19,20) |
| InChIKey | FRLFVPJMMIIYFO-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.26 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|