C20H30ClN7 — CID 109463086
1-[1-(3-chlorophenyl)pyrrolidin-3-yl]-3-[2-(dimethylamino)-2-(1-methylpyrazol-4-yl)ethyl]-2-methylguanidine (PubChem CID 109463086) has the molecular formula C20H30ClN7 and a molecular weight of 403.96 g/mol. Its IUPAC name is 1-[1-(3-chlorophenyl)pyrrolidin-3-yl]-3-[2-(dimethylamino)-2-(1-methylpyrazol-4-yl)ethyl]-2-methylguanidine.
| Compound Name | 1-[1-(3-chlorophenyl)pyrrolidin-3-yl]-3-[2-(dimethylamino)-2-(1-methylpyrazol-4-yl)ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 109463086 |
| Molecular Formula | C20H30ClN7 |
| Molecular Weight | 403.96 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | 1-[1-(3-chlorophenyl)pyrrolidin-3-yl]-3-[2-(dimethylamino)-2-(1-methylpyrazol-4-yl)ethyl]-2-methylguanidine |
| SMILES | C/N=C(\NCC(c1cnn(C)c1)N(C)C)NC1CCN(c2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C20H30ClN7/c1-22-20(23-12-19(26(2)3)15-11-24-27(4)13-15)25-17-8-9-28(14-17)18-7-5-6-16(21)10-18/h5-7,10-11,13,17,19H,8-9,12,14H2,1-4H3,(H2,22,23,25) |
| InChIKey | PQVPFNOKQOLWFT-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 60.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.96 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|